CSIR NET 2017 (Dec) Question Paper Chemical Sciences

Øekad

fo”k; dksM iqfLrdk dksM

H 2017 (II)
jlk;u foKku 1 A
Lke; : 3:00 ?kaVs
iz’u i= Ikw.kkZad : 200 vad

vuqns’k
1. vkius fgUnh dks ek/;e pquk gS A bl ijh{kk iqfLrdk esa ,d lkS chl (20 Hkkx 'A'esa + 40 Hkkx 'B' + 60
Hkkx 'C' esa ) cgqy fodYi iz’u (MCQ)fn, x, gSa A vkidks Hkkx 'A' esa ls vf/kdre 15 vkSj Hkkx 'B'
esa 35 iz’uksa rFkk Hkkx 'C' esa Lks 25 iz’uksa ds mRrj nsus gSa A ;fn fu/kkZfjr Lks vf/kd iz’uksa ds mRrj fn,
x, rc dsoy igys mRrjksa (Hkkx 'A' Lks 15,Hkkx 'B' ls 35 rFkk Hkkx 'C' ls 25) dh tkap dh tk,xhA
2. vksñ,eñvkjñ mRrj i=d vyx Lks fn;k x;k gS A viuk jksy uEcj vkSj dsUnz dk uke fy[kus Lks igys ;g
tkap yhft, fd iqfLrdk esa i`”B iwjs vkSj lgh gSa rFkk dgha Lks dVs&QVs ugha gSa A ;fn ,slk gS rks vki
bfUothysVj Lks mlh dksM dh iqfLrdk cnyus dk fuosnu dj ldrs gSa A blh rjg Lks vksñ,eñvkjñ mRrj
i=d dks Hkh tkap ysa A bl iqfLrdk esa jQ dke djus ds fy, vfrfjDr iUus layXu gSa A
3. vksñ,eñvkjñ mRrj i=d ds i`”B 1 esa fn, x, LFkku ij viuk jksy uEcj] uke rFkk bl ijh{kk iqfLrdk
dk Øekad fyf[k,] lkFk gh viuk gLrk{kj Hkh vo'; djsa A
4. vki viuh vksñ,eñvkjñ mRrj i=d esa jksy uacj] fo”k; dksM] iqfLrdk dksM vkSj dsUnz dksM ls lacfa /kr
leqfpr o`rksa dks dkys ckWy isu ls vo’; dkyk djsaA ;g ,d ek= ijh{kkFkhZ dh ftEesnkjh gS fd og
vksñ,eñvkjñ mRrj i=d esa fn, x, funs’Z kksa dk iwjh lko/kkuh ls ikyu djsa] ,slk u djus ij dEI;wVj
fooj.kksa dk lgh rjhds Lks vdwfVr ugha dj ik,xk] ftlls varr% vkidks gkfu] ftlesa vkidh vksñ,eñvkjñ
mRrj i=d dh vLohd`fr Hkh ‘kkfey gS] gks ldrh gS A
5. Hkkx 'A' rFkk 'B' esa izR;sd iz’u ds 2 vad vkSj Hkkx 'C' esa izR;sd iz’u 4 vad dk gSaA Hkkx 'A' rFkk 'B'
esa izR;sd xyr mRrj dk _.kkRed ewY;kad @ 0.50 vad rFkk Hkkx 'C' esa @ 1 vad fd;k tk,xkA
6. izR;sd iz’u ds uhps pkj fodYi fn, x, gSa A buesa Lks dsoy ,d fodYi gh Þlghß vFkok ÞloksRZ re gyß
gS A vkidks izR;sd iz’u dk lgh vFkok loksRZ re gy <wa<uk gS A
7. udy djrs gq, ;k vuqfpr rjhdksa dk iz;ksx djrs gq, ik, tkus okys ijh{kkfFkZ;ksa dk bl vkSj vU; Hkkoh
ijh{kkvksa ds fy, v;ksX; Bgjk;k tk ldrk gS A
8. ijh{kkFkhZ dks mRrj ;k jQ iUuksa ds vfrfjDr dgha vkSj dqN Hkh ugha fy[kuk pkfg, A
9. dsydwysVj dk mi;ksx djus dh vuqefr ugha gS A
10. ijh{kk lekfIr ij fNnz fcUnq fpfUgr LFkku ls OMR mRrj i=d dks foHkkftr djsaA bfUothysVj dks ewy
OMR mRrj i=d lkSaius ds i’pkr vki bldh dkWcZuySl izfrfyfi ys tk ldrs gSaA
11. fgUnh ek/;[email protected] ds iz’u esa folaxfr gksus@ik;s tkus ij vaxzsth laLdj.k izekf.kd gksxk A
12. dsoy ijh{kk dh iwjh vof/k rd cSBus okys ijh{kkFkhZ dks gh ijh{kk iqfLrdk lkFk ys tkus dh
vuqefr nh tk,xh A

jksy uacj …………………… vH;FkhZ }kjk Hkjh xbZ tkudkjh dks eSa lR;kfir djrk
gw¡ A
uke ................................ …………………………
bfUothysVj ds gLrk{kj

2

FOR ROUGH WORK

3

भाग\PART A
3. A 2 m long ladder is to reach a wall of height
1.75 m. The largest possible horizontal distance
of the ladder from the wall could be
1. slightly less than 1 m
1. एक लड़के ने लंबाई वाली एक रस्ीh के एक रीरे 2. slightly more than 1 m
को पकड़ा है तथा उीका दी
ू रा रीरा एक r
3. 1 m
4. 1.2 m
त्रिजया वाले पतले भं े ीे बं ा हैर रस्ीh
को तान कर वह लड़का भं े के गिदद चक्कर 4. 11 ीें h लंबे, 8 ीें h चौड़े और 20 ीें h ऊंचे एक
लिाकर रस्ीh को भं े पर लपेाता है र रत्ययेक आयताकार फ्लास्क ें 5 ीें h ऊॅंचाई तक पानh रा
चक्कर ें 10 ीेकण्ै लिते ह।र िकी िि त (रत्ि त है र इी फ्लास्क ें 1 ीें h त्रिजया की िोलाकार 21
ीेकण्ै) ीे लड़का भं े की ओर बढ़ता है ? ींिें रें र िोरलयां ैाली जातh ह।र इीीे पानh की
1. 2. ीतह िकतनh ऊपर उठे िh?

3. 4. 1. 8.8 ीें h 2. 10 ीें h
3. 1 ीें h 4. 0 ीें h
1. A boy holds one end of a rope of length and
the other end is fixed to a thin pole of radius r 4. A rectangular flask of length 11 cm, width 8 cm
. Keeping the rope taut, the boy goes and height 20 cm has water filled up to height 5
around the pole causing the rope to get wound cm. If 21 spherical marbles of radius 1 cm each
around the pole. Each round takes 10 s. What is are dropped in the flask, what would be the rise
the speed (in units of s-1) with which the boy in water level?
approaches the pole? 1. 8.8 cm 2. 10 cm
3. 1 cm 4. 0 cm
1. 2.
3. 4. 5. द्ववचर ( ार, ऊँचाई) आलेभ ें कांाूर लि ि
ीें ान जनींख्या वाले आलेभ के ािों को जोड़ते
2. ााइलों को त्रबना तोड़े, ें ाप की n ााइल ह।र ि नम्न ें ीे कौन-ीा कथन ीही है ?
लघुयतें ें ाप के विादकार र्द पर इी रत्कार त्रबााई
जातh ह। िक विद का कोई h ाि भाली नहीं रहतार
n का ें ान ज्ञात कीजजयेर
1. 56 2. 12
3. 24 4. 48

2. The smallest square floor which can be completely
paved with tiles of size without breaking
any tile, needs n tiles. Find n. 1. जनींख्या की ऊंचाई व ार ें कोई ीह-ीबं
1. 56 2. 12
नहीं है र
3. 24 4. 48
2. हलके ययजक्तयों की अपेक्षा ारी ययजक्तयेां की
3. 2 ें hार लंबाई वाली एक ीhढ़ी को एक दीवार पर लंबाई के कहीं अग क होने की ीं ावना है र
इी तरह लिाना है िक वह 1.75 ें hार ऊंचाई तक 3. लंबे व हलके ययजक्तयों की ींख्या लंबे व ारी
पहुंचरे दीवार ीे ीhढ़ी की अग कतें क्षैि तज दरू ी हो ययजक्तयों ीे अग क है र
ीकतh है :- 4. ें ध्यें ार व ें ध्यें लंबाई वाले ययजक्त नहीं ह।र
1. 1 ें hार ीे थोड़ा कें
2. 1 ें hार ीे थोड़ा अग क 5. Contours in the bivariate (weight, height) graph
connect regions of approximately equal popula-
3. 1 ें hार tions. Which of the following interpretations is
4. 1.2 ें hार correct?

4

1. The motion is uniform
2. The speed between P3 and P4 is greater
than that between P5 and P6
3. The speed from P1 to P2 increases because
of downward slope
4. The section P3 to P4 is covered at the
slowest speed

7. एक नये ाायर का अग कतें 90 km तक उपयोि
िकया जा कीता है र एक स्ाे पनh युक्त ि तपिहया
1. There is no correlation between height and
वाहन िकतनh अग कतें दरू ी (िकें h. ें ) तय कर
weight of the population
2. Heavier individuals are likely to be taller ीकता है जबिक उीके ी h चारों ाायर नये ह। ?
than lighter individuals 1. 180 2. 90
3. Taller and lighter individuals are more in 3. 120 4. 270
number than taller and heavier individuals
4. There are no individuals of medium 7. A new tyre can be used for at most 90 km.
weight and medium height What is the maximum distance (in km) that can
be covered by a three wheeled vehicle carrying
6. एक ीें तल रातल के त्रबंदओ
ु ं P1 तथा P10 के बhच one spare wheel, all four tyres being new?
1. 180 2. 90
एक िि त्hल वस्तु का पथ द्ादया िया है , तथा
3. 120 4. 270
उीकी जस्थि तयों को 1 ीैकण्ै के अंतराल पर
गचजहहत िकया िया है र ि नम्न ें ीे कौन-ीा कथन 8. एक ें ाप की ीें ान ें ोााई वाली प्ले ा
ीही है ? का ार 20 kg है र इीें ें ाप के
1000 ाे द िकये जाते ह।र ाे दने के पशचात ् प्लेा का
ार (kg ें ) िकतना है ?
1. 10 2. 2
3. 19.8 4. 18

8. A plate of size with uniform
thickness, weighing 20 kg, is perforated with
1. िि त एकीें ान है र 1000 holes of size. What is the
2. P3 तथा P4 के बhच की िि त P5 तथा P6 के weight of the plate (in kg) after perforation?
बhच की िि त ीे अग क है र 1. 1 0 2. 2
3. 19.8 4. 18
3. ढ़लान के कारण P1 ीे P2 तक जाने पर िि त
बढ़तh है र 9. एक 5 cm  5 cm आंतररक अनरत्
ु स्थ काा वाले
4. P3 ीे P4 का ाि ीबीे कें िि त ीे तय विादकर स्ाै ण्ै ें 0.5 cm ययाी की अग कतें
िकया जाता है र िकतनh बेलनाकार परीलों को भड़ा िकया जा ीकता
है ?
6. A path between points P1 and P10 on a level
1. 99 2. 121
ground is shown, and positions of a moving
3. 100 4. 105
object at 1 second intervals are marked. Which
of the following statements is correct?
9. What is the maximum number of cylindrical
pencils of 0.5 cm diameter that can be stood in
a square shaped stand of 5 cm  5 cm inner
cross section?
1. 99 2. 121
3. 100 4. 105

5

10. दो ींख्याओं का योि, 11 के विद व 9 के घन के 1. If a patient dies even with excellent medical
care, he likely had terminal illness.
योि के बराबर है र बड़h ींख्या 25 के विद ीे
2. If a person gets employed, he has good
कें है र तो ाोाी ींख्या के 24 रत्ि त्त के दो िुणे qualifications.
व बड़h ींख्या के आ े का योि िकतना है ? 3. If an integer is even, it is divisible by two.
1. 415 2. 400 4. If an integer is odd, it is not divisible by two.
3. 410 4. 420
14. 12 cm ज
ु ा वाले विद के चारों कोनों ीे ज
ु ा वाले
10. The sum of two numbers is equal to sum of विों को कााकर, तयपशचात ् िकनारों को ें ोड़कर एक
square of 11 and cube of 9. The larger number
िकशतh बनानh है र िकशतh के अग कतें आयतन के
is less than square of 25. What is the
value of the sum of twice of 24 percent of the रलए का ें ान बताय?
smaller number and half of the larger number? 1. 6 cm 2. 2 cm
1. 415 2. 400 3. 3 cm 4. 4 cm
3. 410 4. 420
14. Four small squares of side x are cut out of a
11. 2 m  2 m  10 cm ें ाप के एक भुले िढ्ड़े ें square of side 12 cm to make a tray by folding
the edges. What is the value of so that the
िकतने आयतन ें द
ृ ा री है?
3 tray has the maximum volume?
1. 40 m 2. 0.4 m3 1. 6 cm 2. 2 cm
3. 0 m3 4. 4.0 m3 3. 3 cm 4. 4 cm
11. What is the volume of soil in an open pit of size
15. दो ावक A और B एक वत
ृ ाकार ट्रे क के ययाी के
2 m  2 m  10 cm?
1. 40 m3 2. 0.4 m3 दो ववपरीत रीरों ीे ट्रे क की एक ही िद्ा ें दौड़ना
रत्ारं करते ह।र यिद A 8 km/h की ि नयत चाल ीे
3
3. 0 m 4. 4.0 m3
तथा B 6 km/h की ि नयत चाल ीे दौड़ते हुए, A
12. A तथा B के िकन ें ानों के रलए है ?
30 रें ना पशचात ् B को रें लता है तो ट्रे क की
1. 2.
लंबाई िकतनh है ?
3. 4. 1. 1 km 2. 4 km
3. 3 km 4. 2 km
12. For which values of A and B is ?
1. 2. 15. Two runners A and B start running from
3. 4. diametrically opposite points on a circular track
in the same direction. If A runs at a constant
speed of 8 km/h and B at a constant speed of 6
13. ि नम्न कथनों ें ीे िकीका ववलोें ीही नह ीं है ? km/h and A catches up with B in 30 minutes,
1. यिद कोई रोिh श्रेष्ठतें गचिकयीा रें नले पर what is the length of the track?
1. 1 km 2. 4 km
h ें र जाता है , तो उीकी जानलेवा बhें ारी
3. 3 km 4. 2 km
हो ीकतh थhर
2. यिद िकीh को नौकरी रें ल जातh है , तो 16. एक वयृ त का तhन चौथाई ाि गचि ें द्ादया
उीकी योग्यता अ्ाी है र िया है OA तथा OB परस्पर लंबवत दो त्रिजयाय
3. यिद कोई पूणाांक ीें है , तो वह पूणाांक दो ीे है र त्रबंद ु C वयृ त पर जस्थत है र
वव ाजजत होता है र
4. यिद कोई पूणाांक ववषें है , तो वह पूणाांक दो
ीे वव ाजजत नहीं होतार

13. For which one of the following statements is
the converse NOT true?

कोण ACB का ें ान बताओ?

6

1. ि न ादररत नहीं िकया जा ीकता दी
ू री जंजhर का वजन 22 ग्राें है र ि नम्न ें ीे
2. 30 कौन-ीा कथन ीही है ?
3. 60 1. 22 कैरे ा की जंजhर ें 18 कैरे ा की जंजhर ीे
4. 45
िुणा जयादा ीोना है र
16. Three-quarters of a circle is shown in the 2. 22 कैरे ा की जंजhर ें 18 कैरे ा की जंजhर ीे
figure; OA and OB are two radii perpendicular
िुणा जयादा ीोना है र
to each other. C is a point on the circle.
3. दोनों जंजhरों ें ीोने की ें ािा ीें ान है र
4. 22 कैरे ा की जंजhर की अपेक्षा 18 कैरे ा की
जंजhर ें िुणा अग क ीोना है र

18. A person purchases two chains from a jeweller,
one weighing 18 g made of 22 carat gold and
another weighing 22 g made of 18 carat gold.
Which one of the following statements is
correct?
What is angle ACB? 1. 22 carat chain contains times more gold
1. Cannot be determined than 18 carat chain
2. 30
2. 22 carat chain contains times more gold
3. 60
4. 45 than 18 carat chain
3. Both chains contain the same quantity of
17. एक हरी पवियों वाले पौ े को एक अं ेरे कें रे ें gold
4. 18 carat chain contains times more gold
ें ाि हरे रत्का् ें रभने पर हें क्या िदभायh दे िा?
than 22 carat chain
1. आीपाी की तल
ु ना ें पौ ा अग क चकें ता
िदभता है र 19. लापता रत्ि तें ान बताईये
2. आीपाी की तुलना ें पौ ा अग क िहरा
िदभायh दे िार
3. पौ े व पयादवरण ें कोई ेद नहीं िकया जा
ीकतार
4. पौ े ें ीाें ाहय ीे अग क रत्का् ींशलेषण
रत्ििया होिhर

17. If a plant with green leaves is kept in a dark
room with only green light ON, which one of
the following would we observe?
1. The plant appears brighter than the
surroundings
2. The plant appears darker than the
surroundings
3. We cannot distinguish the plant from the
surroundings
4. It will have above normal photosynthetic
activity

18. एक ययजक्त िकीh ीुनार ीे ीोने की दो जंजhर
भरीदता है र 22 कैरे ा ीोने ीे बनh पहली जंजhर
का वजन 18 ग्राें है तथा 18 कैरे ा ीोने ीे बनh

7

भाग\PART B
19. Find the missing pattern

21. तापhय हयट्र
ू ोनों की ि नम्नरलिभत अर िियाओं
ें ीे िकीके रलए िोी-ीेक््न ीवादग क है र

1. 92U235 + 0n1  92U235 + 0n1
2. 92U235 + 0n1 92U236
3. 92U235 + 0n1  90Th232 + 2He4
4. 92U235 + 0n1  36Kr94 + 56Ba140 + 2 0n1

21. Among the following nuclear reactions of
thermal neutrons, the cross section is
highest for
1. 92U235 + 0n1  92U235 + 0n1
2. 92U235 + 0n1 92U236
3. 92U235 + 0n1  90Th232 + 2He4
4. 92U235 + 0n1  36Kr94 + 56Ba140 + 2 0n1

22. जजी अनें
ु ापन के अंयय त्रबहद ु को ज्ञात करने
के रलए स्पेक्ट्रें -रत्का्ें ापh ें ानhारन उपयक्
ु त
नह ीं है , वह है

1. ऑक्ीैरलक अम्ल vs पोाै र्यें परें िनेा
2. आयरन(II) vs 1,10-िरनैहरोलीन
20. एक ही रत्जाि त ें ाोाे व बड़े दोनों तरह के जhवाणु 3. कोबाला(II) vs ऐररओिोें बलैक - T
पाये जाते ह।र यिद जhवाणु का ीतही क्षेिरल S है 4. ि नकैल(II) vs ैाईें ेगथलग्लाइआजक्ीें
तथा आयतन V है तो ि नम्न ें ीे कौन-ीा कथन
ीही है ? 22. Spectrophotometric monitoring is not
1. Ssmall > Slarge suitable to determine the end point of
titration of
2. V small > Vlarge 1. oxalic acid vs potassium permanganate
3. (S/V)small > (S/V)large 2. iron(II) vs 1,10-phenanthroline
4. (S/V)small < (S/V)large 3. cobalt(II) vs eriochrome black T
4. nickel(II) vs dimethylglyoxime
20. There are small and large bacteria of the same
23. रत्थें आयनhकरण ऊजाद जजीके रलए हयन
ू तें
species. If S is surface area and V is volume,
then which of the following is correct? है , वह है
1. Ssmall > Slarge 1. Br 2. Se
2. V small > Vlarge 3. P 4. As
3. (S/V)small > (S/V)large 23. The first ionization energy is the lowest
4. (S/V)small < (S/V)large for
1. Br 2. Se
3. P 4. As

8

24. ClO3, XeO3 तथा SO3 ें ीे वपरै रें ैh आकृि त 27. The correct statement for cytochrome c is
की स्पh्h ह है / ह।? 1. It is a non-heme protein
2. The coordination number of iron in
1. ClO3 तथा XeO3 cytochrome c is five.
2. XeO3 तथा SO3 3. It is a redox protein and an electron carrier
3. ClO3 तथा SO3 4. It can store or carry dioxygen
4. SO3
28. SNF3 तथा XeF2O2 की जयारें ि तयां ह। िें ्:
24. Among ClO3, XeO3 and SO3, species 1. विद तलीय तथा विद तलीय
with pyramidal shape is/are? 2. चतुष्रलकीय तथा चतुष्रलकीय
1. ClO3 and XeO3 3. विद तलीय तथा त्रिीें नताक्ष द्वववपरैरें ैhय
2. XeO3 and SO3
3. ClO3 and SO3 4. चतुष्रलकीय तथा त्रिीें नताक्ष द्वववपरैरें ैhय
4. SO3
28. Geometries of SNF3 and XeF2O2,
25. औद्योगिक बहुलीकरण उयपेरक के प प ें BF3 respectively, are
1. square planar and square planar
का कायद जजीको उयपहन करना है , वह है
2. tetrahedral and tetrahedral
1. काबदऋणायन 2. काबो नायन 3. square planar and trigonal bipyramidal
3. काबदि नक ें ल
ू क 4. नायन ें ल
ू क 4. tetrahedral and trigonal bipyramidal

25. The role of BF3 as an industrial 29. Co(CO)4H के IR स्पेक्ट्रें ें 2121, 2062,
polymerization catalyst is to generate 2043 तथा 1934 cm-1 पर बैहै िदभते ह।र
1. carbanion 2. carbocation Co(CO)4D के स्पेक्ट्रें ें νCo-D (cm-1 ें )
3. organic radical 4. cation radical
रत्ययार्त है
26. ि नम्नरलिभत ींकुलों के रलए चम्
ु बकीय आघण
ू द 1. 2111 पर 2. 1396 पर
(केवल जस्पन ें ान) बढ़ने का िें हैर 3. 2053 पर 4. 1910 पर
A. [TiF6]3– B. [CrF6]3– C. [MnF6]3–
D. [CoF6]3– 29. The IR spectrum of Co(CO)4H shows
1. D < A < B < C 2. C < A < D < B bands at 2121, 2062, 2043 and 1934 cm-1.
3. B  A < D < C 4. A < B < C  D The νCo-D (in cm-1) expected in the
spectrum of Co(CO)4D is
26. For the following complexes, the increasing 1. 2111 2. 1396
order of magnetic moment (spin only value) is 3. 2053 4. 1910
A. [TiF6]3– B. [CrF6]3– C. [MnF6]3–
D. [CoF6]3– 30. त्रिीें नताक्ष वरत्जें hय रलिहै क्षेि ें ीवादग क
1. D < A < B < C 2. C < A < D < B स्थाि ययव रत्ाप्त करने वाला d-कक्षक है
3. B  A < D < C 4. A < B < C  D 1. dz2 2. dxy
3. dxz 4. dyz
27. ीाइाोिोें c के रलए ीही कथन है
1. यह एक अ-हीें रत्ोाीन हैर 30. In trigonal prismatic ligand field, the most
stabilized d orbital is
2. आयरन की ीाइाोिोें c ें ीें हवय ींख्या
1. dz2 2. dxy
पांच होतh है र 3. dxz 4. dyz
3. यह एक रे ैोक्ी रत्ोाीन तथा इलेक्ट्रान वाहक हैर
4. यह ैाइआक्ीhजन का ींग्रह अथवा वहन कर
ीकतh है र

9

31. इलेक्ट्रो-उदाीhनता रीद् ाहत के आ ार पर 1. 2.
ि नम्नरलिभत ें ीे कौन-ीा ींकुल ीवादग क
अस्थायh है
1. [Al(OH2)6]3+ 2. [Al(NH3)6]3+
3. [AlF6]3 4. [Al(NCCH3)6]3+ 3. 4.

31. The most unstable complex on the basis
of electro-neutrality principle among the
following is 34. Among the following, the compound that
1. [Al(OH2)6]3+ 2. [Al(NH3)6]3+ gives base peak at m/z 72 in the EI mass
3
3. [AlF6] 4. [Al(NCCH3)6]3+ spectrum is

32. I2 के इलेक्ट्राि नक स्पेक्ट्रें ें 520 nm पर 1. 2.
उपजस्थत बैहै, जजीें ीवादग क बलूर्फ्ा ीहता
है , वह है
1. जल 2. हे क्ीेन 3. 4.
3. बेहजhन 4. ें ेथैनैल

32. The band in the electronic spectrum of I2
appearing at 520 nm will undergo
35. ि नम्नरलिभत अणु ें
maximum blue shift in
1. water 2. hexane
3. benzene 4. methanol

33. ि नम्नरलिभत ें ीे असींगत है 1. ीें रें ि त तल है
1. लैहथेनाइैों ें तhर स ींिें ण तथा रत्ि तदीजप्त 2. R ींप पण है
2. ववस्तत
ृ बैहै तथा d-d ींिें ण 3. S ींप पण है
3. अययग क जस्पन-आत्रबदा यग्ु ें न तथा 4. ीें रें ि त केहद्र है
ींिें ण तयव
4. आवे् स्थानाहतरण तथा 104 L mol–1cm–1 35. The following molecule has
कोिा की ें ोलर अव्ोषकता

33. Mismatch among the following is
1. Sharp transition and fluorescence in 1. plane of symmetry
lanthanides 2. R configuration
2. Broad bands and d-d transitions 3. S configuration
3. Very high spin-orbit coupling and 4. centre of symmetry
transition elements
4. Charge transfer and molar absorptivity 36. ि नम्नरलिभत रत्ाकृि तक उयपाद एहारोैाइऑल
of the order of 104 L mol–1cm–1

34. ि नम्नरलिभत ें ीे यौगिक जो EI द्रययें ान
स्पेक्ट्रें ें m/z, 72 पर आ ार र्भर दे ता है ,
वह है

10

है , एक 3.
1. ापीन 2. स्ाे रोयै
3. रलग्नन 4. ऐलकेलोइै
4.
36. The following natural product Enterodiol
is a

38. The kinetic product formed in the
following reaction is

1. terpene 2. steroid
3. lignan 4. alkaloid
1.
37. ि नम्नरलिभत हे ाेरोीाइिकलों की क्षारीयता का
ीही िें है
2.

3.
1. A > C > B 2. C > A > B
3. C > B > A 4. B > A > C

37. The correct order of basicity for the 4.
following heterocycles is

39. ि नम्नरलिभत ींरचनों ें ीे वह एक, जो यौगिक
A के ीवादग क स्थायh ींप पण ीे ींित करतh है
1. A > C > B 2. C > A > B
3. C > B > A 4. B > A > C

38. ि नम्नरलिभत अर ििया ें उयपहन िि तक
उयपाद है
1.

2.
1.
3.

2. 4.

11

39. Among the structures given below, the
1.
one that corresponds to the most stable
conformation of compound A is
2.

3.

4.
1.

ि नम्नरलिभत यौगिक के रत्ोाान अयजु ग्ें त
13
41. C
2. NMR स्पेक्ट्रें ें रत्ेिक्षत रीग्नलों की ींख्या है

3.

4.
1. पांच 2. ा:
3. दी 4. तेरह

41. The number of signals observed in the
40. फ्रंिायर आजण्वक आत्रबा
द ल (FMO) रीद् ांत के proton decoupled 13C NMR spectrum of
the following compound is
अनुीार हे क्ीाट्राइईन का ीवो्च अग कृत
आणववक आत्रबदाल (HOMO) ि नम्नरलिभत
अर ििया ें है

1. five 2. six
3. ten 4. thirteen
1.
42. ि नम्नरलिभत काबो नायनों के स्थायhयव का
ीही िें है
2.

3.

4.
1. A > C > B 2. B > C > A
3. C > A > B 4. C > B > A
40. According to Frontier Molecular Orbital
(FMO) Theory, the Highest Occupied 42. The correct order of stability of the
Molecular Orbital (HOMO) of hexatriene following carbocations is
in the following reaction is

12

1. A > C > B 2. B > C > A 45. कोलें P ें िदये यौगिकों का कोलें Q ें दी
3. C > A > B 4. C > B > A िई IR तनन आववृ ियों (cm ) ीे ीही रें लान
-1

है
43. एक रत्का्त: ्द्
ु काबदि नक यौगिक का ध्रुवण
कोलें P कोलें Q
घूणाांक +40 है र +32 का ध्रुवण घूणादक द्ादने
o o

वाले एक नें न
ू े की रत्का्hय ्द्
ु ता है र
I A 1865
1. 8% 2. 12%
3. 20% 4. 80%

43. An optically pure organic compound has II B 1770
specific rotation of +40o. The optical
purity of the sample that exhibits specific III C 1745
rotation of +32o is
1. 8% 2. 12%
3. 20% 4. 80% 1. I - B; II - C; III - A
2. I - C; II - A; III - B
3. I - C; II - B; III - A
44. ि नम्नरलिभत अर ििया ें ववरगचत ें ुख्य उयपाद है 4. I - A; II - C; III - B

45. Correct match of the compounds in
Column P with the IR stretching
frequencies (cm-1) in Column Q is
1. 2.
Column P Column Q

I A 1865

3. 4.
II B 1770

III C 1745
1. I - B; II - C; III - A
44. The major product formed in the
2. I - C; II - A; III - B
following reaction is
3. I - C; II - B; III - A
4. I - A; II - C; III - B

46. ि नम्नरलिभत आंकड़े द्ादने वाला ीही काबदि नक
1. 2. यौगिक है
1
H NMR (400 MHz):  7.38 (d), 7.25 (d),
1.29 (s) ppm

3. 4. 1. 2.

13

3. 4. 49. ें बोरान का
1. ींकरण है 2. ींकरण है
3. ींकरण है 4. काई ींकरण नहीं

49. Boron in has
1. hybridization
2. hybridization
46. The organic compound that displays 3. hybridization
following data is 4. no hybridization
1
H NMR (400 MHz):  7.38 (d), 7.25 (d),
1.29 (s) ppm 50. हाइड्रोजन जैीे परें ाणु की ें ख्
ु य क्वाहाें
ींख्या के रलए अपभ्रष्ा त्रिववें
1. 2.
आत्रबदालों की ींख्या है
1. 12 2. 6
3. 72 4. 36

50. The number of degenerate spatial orbitals
of a hydrogen-like atom with principal
3. 4. quantum number is
1. 12 2. 6
3. 72 4. 36

51. यिद तथा है , तो
ि नम्नरलिभत ें ीे कौन-ीा ननश्चित प प ीे
लािू होता है: [ तथा आपरे ार ह।]
47. ि नम्नरलिभत ें ीे अणु जजीें ीें रें ि त
अक्ष है , वह है 1. 2.
1. 2. 3. 4.
3. 4.
51. If and , then which
47. The molecule with a axis of symmetry of the following necessarily holds: [
among the following is and are operators]
1. 2. 1. 2.
3. 4. 3. 4.

48. ि नम्नरलिभत ें ीे अणु जो राें न स्पेक्ट्रें
52. ि नम्नरलिभत ें ीे ीही कथन है ( एक
द्ादयेिा परहतु IR स्पेक्ट्रें नहीं, वह है
हरें दाी ऑपरे ार है)
1. 2.
1. के आइिेन ें ान ऋृणायें क हो ीकते ह।र
3. 4.
2. के आइिेन ें ान ीदा नायें क होते ह।र
3. का कोई h आइिेन रलन का आइिेन
48. The molecule that will show Raman
spectrum, but not IR spectrum, among the रलन नहीं है र
following is 4. के आइिेन ें ान ीजम्ें श्र हो ीकते ह।र
1. 2.
3. 4.

14

52. The correct statement among the 1. कणों की ीतह पर उपजस्थत वैद्यत
ु द्ववक
following is ( is a hermitian operator ) स्तर का
1. The eigenvalues of can be 2. कणों के ें ध्य वाहैर वाली बलों का
negative. 3. कणों के ीूक्ष्ें आकार का
2. The eigenvalues of are always 4. कणों की आकृि त का
positive.
3. No eigenfunction of is an
55. The stability of lyophobic colloids is a
eigenfunction of . consequence of the
4. The eigenvalues of can be
complex. 1. electrical double layer at the surface
of the particles.
2. van der Waals force between the particles.
53. ििस्ाल की एकक ीेल ें परें ाणओ
ु ं/आयनों को
3. small particle size.
एक दी
ू रे ीे स्प्द करते हुए कठोर िोले रलया 4. shape of the particles.
जाए, तो काय केजहद्रत न ींरचना ें अग कृत
आयतन के रलए र हन हैर 56. एक रत्बल ववद्यत
ु अपघ्य की अनंत तनुता पर
तल
ु यांक चालकता जजी आरे भ ीे रत्ाप्त
1. 2.
की जा ीकतh है , वह है
3. 4. 1. vs. 2. vs.
3. vs. 4. vs.
53. If the atoms/ions in the crystal are taken to
be hard spheres touching each other in the 56. The equivalent conductance at infinite
unit cell, then the fraction of volume dilution of a strong electrolyte can
occupied in the body centered cubic be obtained from the plot of
structure is 1. vs. 2. vs.
1. 2. 3. vs. 4. vs.

3. 4. 57. एक ीें कण पररक्षेपh बहुलक के रलए ींख्या-
औीत ें ोलर ींहि त ीे ार-औीत ें ोलर
54. झhल के जल के नें न
ू पर दोहराये िये के ींहि त का जो ींबं है , वह है
ें ापन ने तथा िदया
है , के ें ापन ें ें ानक ववचलन है 1. 2.
1. 2 2. 4 3. 4.
3. 0 4.
57. The number-average molar mass for
54. Repeated measurements of in a lake a monodisperse polymer is related to the
water sample gave and of weight-average molar mass by the
. Standard deviation in the measure- relation
ment of is 1. 2.
1. 2 2. 4 3. 4.
3. 0 4.

55. द्रव-ववरो h कोलाइड़ों की जस्थरता, एक पररणाें 58. िें ाित अर िियाओं के एक िें
है र

15

ें I की ीाहद्रता स्थायh अवस्था ीजहनकान के 4.
अनुीार होिh

1. 2.
3. 4.

58. For a sequence of consecutive reactions,
60. The structure of ribonucleoside uridine is

the concentration of I would be, by 1.
steady state approximation
1. 2.
3. 4.

59. एहथैलपh जजीके ीें ान है , वह है
2.
1.
2.
3.
4.

59. Enthalpy is equal to
1. 3.
2.
3.
4.

60. राइबोहयजू क्लओीाइै यरू रैhन की ींरचना है
4.
1.

भाग\PART C
2.
61. वव ेदी तापhय ववशलेषण वकृ का र्भर क्षेिरल
ि नम्नरलिभत ें ीे एक या अग क के ीें ानुपातh
होता है :
A. ींहि त ें क्षि त
B. नें ूने की ींहि त
3.
C. ववघान/रत्ावस्था पररवतदन ऊष्ें ा
ीही उयतर है
1. केवल A 2. केवल B
3. A तथा C 4. B तथा C

16

61. The peak area of differential thermal analysis b. Eu (ii) MI2 of metallic lustre
curve is proportional to one or more of the c. Ce (iii) Diamagnetic M(III)
following: d. Tb (iv) Pink in oxidation
A. mass loss state III
B. mass of the sample
C. heat of decomposition / phase change Correct match is
The correct answer is 1. a-(iii); b-(ii); c-(i); d-(iv)
1. A only 2. B only 2. a-(ii); b-(iii); c-(iv); d-(i)
3. A and C 4. B and C 3. a-(iv); b-(ii); c-(i); d-(iii)
4. a-(iii); b-(ii); c-(iv); d-(i)
62. 25oC पर आबह पैराें hार ि नकालने के रलए
इलेक्ट्रोन वववतदन रत्ाय: जजन दोनों के रलए 64. ि नम्नरलिभत ें ीे CH2 के ीाथ जो आइीोलोबल
अनुपयुक्त है , वह ह। ह।, वह ह।
1. O3 तथा NO2 A. CpCr(CO)2 B. CpCu
C. Ni(CO)2 D. Cr(CO)4 E. Fe(CO)4
2. ीलरर तथा ्ुष्क ब्द
1. A, C तथा E 2. B, C तथा D
3. NO2 तथा ीलरर
3. B, C तथा E 4. A, B तथा D
4. O3 तथा ्ुष्क ब्द
64. Among the following, species isolobal to CH2 are
62. To determine the bond parameters at 25oC, A. CpCr(CO)2 B. CpCu
electron diffraction is generally unsuitable for C. Ni(CO)2 D. Cr(CO)4 E. Fe(CO)4
both 1. A, C and E 2. B, C and D
1. O3 and NO2 3. B, C and E 4. A, B and D
2. Sulfur and dry ice
3. NO2 and sulfur
्ास््ोें ोरलबैेा ऋणायन [PMo12O40] के रलए
3-
65.
4. O3 and dry ice
ि नम्नरलिभत ें ीे असत्, कथन चि ु नए
63. कोलें I ें िदये िये लैहथेनाइैों का कोलें II ें 1 इीकी केगिन ींरचना होतh है र
िदये िए उनके िुणों ीे रें लान कीजजए 2 ्ास्रोरी
ो़ की ऑक्ीhकरण अवस्था +5 है र
3 यह अययग क क्षारीय होता है र
कोलें I कोलें II 4. यह [R4N] (R = ऐजलकल या ऐररल ग्रुप) के
+

a. Lu (i) ऑक्ीhकरण अवस्था ीाथ ििस्ालीय अवक्षेप दे ता है र
IV ें अर कें दक
b. Eu (ii) ाजयवक चें क का MI2 65. Choose the incorrect statement for the
phosphomolybdate anion, [PMo12O40]3-.
c. Ce (iii) रत्ि तचुम्बकीय M(III)
1 It has a Keggin structure.
d. Tb (iv) ऑक्ीhकरण अवस्था III 2 Phosphorus is in +5 oxidation state.
ें िुलाबh रं ि 3 It is extremely basic.
4. It forms crystalline precipitates with
[R4N]+ (R = bulky alkyl or aryl group)
ीही रें लान है
1. a-(iii); b-(ii); c-(i); d-(iv) 66. ऐजक्ानाइैों (An) के रलए ि नम्नरलिभत कथनों पर
2. a-(ii); b-(iii); c-(iv); d-(i)
ववचार कीजजएर
3. a-(iv); b-(ii); c-(i); d-(iii)
4. a-(iii); b-(ii); c-(iv); d-(i) A. लैहथनाइैों (Ln) की अपेक्षा An ें +3 ीे
अग क ऑक्ीhकरण अवस्था रें लने की
63. Match lanthanides in Column I with their
अग क रत्ाि यकता है र
properties in Column II
B. कुा An(III) आयन d-d ींिें ण द्ादते ह।र
Column I Column II C. UO22+ तथा PuO22+ जस्थर होते ह।र
a. Lu (i) Reagent in oxidation
state IV

17

D. कुा ऐजक्ानाइैों के रे डैयो ें ी ीें स्थाि नक 68. Allred-Rochow electronegativity of an element is
A. directly proportional to the effective
नहीं ह।र
nuclear charge
ीही उयतर है B. directly proportional to the covalent radius
1. A तथा C 2. B तथा D C. inversely proportional to the square of the
covalent radius
3. A, B तथा C 4. B, C तथा D
D. directly proportional to the square of the
effective nuclear charge
66. Consider the following statement(s) for The correct answer is
actinides (An): 1. A and B 2. A and C
A. Oxidation states greater than +3 are more 3. B and C 4. A and D
frequent in An compared to lanthanides (Ln)
B. Some An(III) ions show d-d transitions
69. रत्ोपेनान ीे Br2 एक आवे् स्थानाहतरण ींकुल
C. UO22+ and PuO22+ are stable
D. Some of actinides do not have radioactive बनातh है , तथा I2 के ीाथ I, ट्राइआयोैाइै
isotopes ऋणायन बनातh है र यह ींकेत करता है िक
The correct answer is
1. Br2 तथा I2 दोनों क्षार का कायद करते ह।र
1. A and C 2. B and D
3. A, B and C 4. B, C and D 2. Br2 तथा I2 दोनों अम्ल का कायद करते ह।र
3. Br2 एक अम्ल का कायद करता है तथा I2 क्षार कार
67. बेहा ि नयें ानी
ु ार p-बलाक के तयवों के रलए केहद्रीय 4. Br2 एक क्षार का कायद करता है तथा I2 अम्ल कार
परें ाणु के चारों ओर जयारें तh तथा अग क ऋण
ववद्युतऋणायें क रत्ि तस्थापh के स्थान का ीही 69. Br2 with propanone forms a charge transfer
ींयोि है
complex and I2 forms triiodide anion with I.
This implies that
1. त्रिीें नताक्ष द्वववपरै रें ैhय तथा अक्षhय 1. both Br2 and I2 act as bases
2. त्रिीें नताक्ष द्वववपरै रें ैhय तथा ें ध्यवती 2. both Br2 and I2 act as acids
3. विद वपरै रें ैhय तथा अक्षhय 3. Br2 acts as an acid and I2 acts as a base
4. Br2 acts as a base and I2 acts as an acid
4. विद वपरै रें ैhय तथा आ ाररक
70. ींकुल [Pd(L-L)(Me)(Ph)] ें जो त्रबी-रास्रीन
67. According to Bent’s rule, for p-block elements,
the correct combination of geometry around the (L-L), PhMe के अपचायक ववलोपन को अनें
ु त
central atom and position of more नह ीं करतh है , वह है
electronegative substituent is
1.
1. Trigonal bipyramidal and axial
2. Trigonal bipyramidal and equatorial
3. Square pyramidal and axial
4. Square pyramidal and basal

68. एक तयव की आलरे ै-रो्h ववद्युत ऋणायें कता
A. रत् ावh हयक्
ू लीय आवे् के ीh े ीें ानुपातh है र
B. ीहींयोजक त्रिजया के ीh े ीें ानुपातh है र 2.
C. ीहींयोजक त्रिजया के विद के ययुयिें ानुापातh है र
D. रत् ावh हयक्
ू लीय आवे् के विद के ीh े
ीें ानुपातh है र
ीही उयतर है
1. A तथा B 2. A तथा C
3. B तथा C 4. A तथा D

18

3. 4.

4. 71. नhचे दी ियh आर ििया ें , स्थानाहतर
हाइड्रोजनhकरण अर ििया के रलए अरत् ावh
त्रबीरास्रीन (P-P) है

1. ैाइ्ेि नल ्ास्रीनोें ेथैन
2. 1, 2- ैाइ्ेि नल ्ास्रीनोएथेन
3. 1, 3- ैाइ्ेि नल ्ास्रीनोरत्ोपेन
70. In the complex [Pd(L-L)(Me)(Ph)], the
bisphosphine (L-L) that does not allow 4. 1, 4- ैाइ्ेि नल ्ास्रीनोबयूाेन
reductive elimination of PhMe, is
71. In the reaction given below, the bisphosphine
1. (P-P) that is ineffective for transfer-
hydrogenation reaction is

1. Diphenylphosphinomethane
2. 1,2-Diphenylphosphinoethane
3. 1,3-Diphenylphosphinopropane
4. 1,4-Diphenylphosphinobutane
2.
उ्च तथा हयून जस्पन d अष्ारलकीय ींकुलों ें
6
72.
रत्ाय: रत्ेिक्षत जस्पन अनुें त ींिें ण ह। िें ्: (ML6)
1. दो तथा एक 2. एक तथा दो
3. ्ूहय तथा एक 4. दो तथा दो

72. For high spin and low spin d6 octahedral
complexes (ML6), the generally observed spin
3. allowed transitions, respectively, are
1. two and one 2. one and two
3. zero and one 4. two and two

73. नhचे दी ियh अर िियाय उदाहरण ह।
A. Cl2 + 2H2O  HOCl + H3O+ + Cl
B. Cl2 + 2NH3  NH2Cl + NH4+ + Cl
1. केवल अीें ानुपातन का
2. अीें ानुपातन (A) तथा ववलायकीयन (B) का

19

3. ववलायकीयन (A) तथा अीें ानुपातन (B) का
4. जैीे ववलायक अपघान वैीे ही अीें ानप
ु ातन का

73. The reactions given below,
A. Cl2 + 2H2O  HOCl + H3O+ + Cl
B. Cl2 + 2NH3  NH2Cl + NH4+ + Cl
are examples of
1. disproportionation only 76. K3CuF6 तथा KCuL2, [H2L =
2. disproportionation (A) and solvation (B)
3. solvation (A) and disproportionation (B) H2NCONHCONH2] ें Cu के इदद गिदद जयारें तh
4. solvalysis as well as disproportionation तथा जस्पन अवस्था ह।, िें ्:
1. (अष्ारलकीय, उ्च-जस्पन) तथा (विद
वेै के ि नयें ों के अनुीार [Sn9] क्लस्ार का रत्कार
4
74.
ीें तलीय, हयून-जस्पन)
तथा जयारें तh िें ्: ह।
2. (अष्ारलकीय, हयन
ू -जस्पन) तथा (विद
1. closo तथा ट्राइ कैपै त्रिीें नताक्ष वरत्ज़्ें hय
ीें तलीय, हयून-जस्पन)
2. nido तथा ें ोनो कैपै विद रत्ि त वरत्ज़्ें hय
3. (त्रिीें नताक्ष वरत्ज़्ें hय, उ्च-जस्पन) तथा
3. arachno तथा ीप्त ज
ु hय द्वववपरै रें ैhय
(चतुष्रलकीय, उ्च-जस्पन)
4. closo तथा ें ोनो कैपै विद रत्ि त वरत्ज़्ें hय
4. (त्रिीें नताक्ष वरत्ज़्ें hय, हयून-जस्पन) तथा
74. According to Wade’s rules, the cluster type and (चतष्ु रलकीय, उ्च-जस्पन)
geometry of [Sn9]4, respectively, are
1. closo and tricapped trigonal prismatic 76. The geometry around Cu and its spin state for
2. nido and monocapped square-antiprismatic K3CuF6 and KCuL2, [H2L = H2NCONHCONH2],
3. arachno and heptagonal bipyramidal respectively are:
4. closo and monocapped square antiprismatic 1. (octahedral, high-spin) and (square
planar, low-spin)
75. 1
JPH > 1JPB ें ानकर H3P:11BCl3 [11B, के रलए I =3/2] 2. (octahedral, low-spin) and (square
planar, low-spin)
का अपेिक्षत P NMR स्पेक्ट्रें है र
31
3. (trigonal prismatic, high-spin) and
(tetrahedral, high-spin)
4. (trigonal prismatic, low-spin) and
(tetrahedral, high-spin)

77. आक्ीh हीें ररगरन के ीििय स्थल की ींरचना है र
1.

2.

75. Assuming 1JPH > 1JPB, the expected 31P NMR
spectrum of H3P:11BCl3 [for 11B, I =3/2] is

20

हे प्ाा ीें हवयh Co स्पh्hज एक ें ध्यवती है र
3+
3. C.
ीही कथन है /ह।
1. A तथा B 2. A तथा C
3. B तथा C 4. केवल C

78. Consider the following statements with respect
4. to the base hydrolysis of [CoCl(NH3)5]2+ to
[Co(NH3)5(OH)]2+.
A. One of the ammonia ligands acts as a
Brnsted acid.
B. The entering group is water.
C. A heptacoordinated Co3+ species is an
intermediate.
The correct statement(s) is/are
77. The active site structure for oxy-hemerythrin is: 1. A and B 2. A and C
3. B and C 4. C only
1.
79. क्यूबेन जैीh रेरीैाजक्ीन ें अकाबदि नक ीलराइैों
की ींख्या तथा उनके पथ
ृ क्करण की ववग है िें ्:
1. आठ तथा एक अम्ल ीे ुलाई
2. चार तथा एक क्षार ीे ुलाई
3. आठ तथा एक क्षार ीे ुलाई
2.
4. चार तथा एक अम्ल ीे ल
ु ाई

79. The number of inorganic sulfides in cubane like
ferredoxin and their removal method,
respectively, are
1. eight and washing with an acid
3. 2. four and washing with a base
3. eight and washing with a base
4. four and washing with an acid

80. थायोीायनेा के उ यदं तरु ययवहार को ध्यान
ें रभकर ि नम्न ींरचनाओं ें ीे ीवादग क
जस्थर कौन-ीh है
4.
1.

2.
78. [CoCl(NH3)5]2+ के [Co(NH3)5(OH)]2+ ें क्षारीय
जल अपघान के रलए ि नम्नरलिभत कथनों पर
ववचार कीजजएर
A. एक अें ोि नया रलिहै ्रनहीाे द अम्ल जैीा
कायद करता है र
B. रत्वे् करने वाला ग्रुप जल है र

21

3.
1.

2.
4.

3.

4.
80. Considering the ambidentate behaviour of
thiocyanate ion, the most stable structure
among the following is

81. Major product of the following reaction is
1.

2.
1.

2.
3.

3.

4. 4.

82. ि नम्नरलिभत अर ििया ें ें ख्
ु य उयपाद है र

81. ि नम्नरलिभत अर ििया का ें ुख्य उयपाद है र

1. 2.

22

3. 4.

1.
82. Major product in the following reaction is

2.

1. 2.
3.

3. 4.

4.

83. ि नम्नरलिभत अर ििया िें ें ें ख्
ु य उयपाद A
तथा B ह।र

84. ि नम्नरलिभत अर ििया ें उयपहन ें ुख्य उयपाद है र

1.

1. 2.
2.

3. 4.
3.

84. The major product formed in the following
4. reaction is

83. Major products A and B of the following
reaction sequence are

23

1. 2. 4.

3. 4. 86. ि नम्न अर ििया ें ववरगचत ें ुख्य उयपाद है

85. ि नम्नरलिभत अर ििया िें के ें ुख्य उयपाद A
तथा B ह।

1.

1.

2.

2.
3.

3. 4.

86. The major product formed in the following
4. reaction is

85. Major products A and B of the following
reaction sequence are

1.

1. 2.

3.
2.

4.

3.

24

87. A को B ें पररवि तदत करने के रलए आवशयक 1. ें ाइकेल ींकलन, ऐलैोल ींघनन, syn-
अर कें दकों (i)-(iii) का ीही िें है ववलोपन, कीाो-ईनोल चलावयवता
2. ऐलैोल ींघनन, इलेक्ट्रोीाइजक्लक ररंि
क्लोरींि, syn- ववलोपन, ववहाइड्रोजनhकरण
3. ें ाइकेल ींकलन, क्लेजन ींघनन, anti-
ववलोपन, कीाो-ईनोल चलावयवता
(i) थायोि नल क्लोराइै, (ii) 4-क्लोरोवपररैhन, 4. रोत्रबनीन वलयन, ववहाइड्रोजनhकरण, anti-
(iii) वपपेररैhन ववलोपन
1. (i), (ii) तथा (iii) 2. (i), (iii) तथा (ii)
89. Correct sequence of steps involved in the
3. (ii), (i) तथा (iii) 4. (iii), (i) तथा (ii)
following transformation is
87. Correct sequence of reagents (i)-(iii) required
for the conversion of A to B is

1. Michael addition, aldol condensation,
syn-elimination, keto-enol tautomerism
2. aldol condensation, electrocyclic ring
(i) Thionyl chloride, (ii) 4-Chloropyridine, closing, syn-elimination,
(iii) Piperidine dehydrogenation
1. (i), (ii) and (iii) 2. (i), (iii) and (ii) 3. Michael addition, Claisen condensation,
3. (ii), (i) and (iii) 4. (iii), (i) and (ii) anti-elimination, keto-enol tautomerism
4. Robinson annulation, dehydrogenation,
88. ि नम्नरलिभत अर ििया ें ीजम्ें रलत है
anti-elimination

90. ि नम्न अर ििया िें ें ें ुख्य उयपाद A तथा B ह।र

1. [1,2] रीग्ें ाट्रावपक पन
ु ववदहयाी
2. [2,3] रीग्ें ाट्रावपक पुनववदहयाी
3. [3,3] रीग्ें ाट्रावपक पुनववदहयाी
1.
4. C-H ि नवे्न अर ििया

88. The following reaction involves
2.

1. [1,2] sigmatropic rearrangement 3.
2. [2,3] sigmatropic rearrangement
3. [3,3] sigmatropic rearrangement
4. C-H insertion reaction
4.
89. ि नम्न प पाहतरण ें अपेिक्षत पदों का ीही िें है

25

90. The major products A and B in the following
3. 4.
reaction sequence are

92. CH3-CH(OH)-CH(OH)-CH(OH)-CH3 के रलए
1. ीं व ध्रुवण घूणी त्रिववें ीें ावयवh ह।र
1. दो 2. चार
3. ा: 4. आठ

2. 92. The number of optically active stereoisomers
possible for CH3-CH(OH)-CH(OH)-CH(OH)-
CH3 is
1. two 2. four
3. 3. six 4. eight

93. कालें P ें िोले द्वारा घेरे िये रत्ोाानों और कालें
Q की 1H NMR राीायि नक ीि ृ त ( ppm) का ीही
4.
रें लान है

P Q

91. ि नम्न अर ििया िें ें उयपहन ें ुख्य उयपाद है I A 6.72

II B 16.4

1. 2.

III C – 0.61
3. 4.

1. I – A; II – B; III – C
2. I – B; II – A; III – C
3. I – B; II – C; III – A
91. The major product formed in the following 4. I – C; II – B; III – A
reaction sequence is
93. The correct match of the circled protons in
Column P with the 1H NMR chemical shift (
ppm) in Column Q is
P Q

1. 2.
I A 6.72

26

1.
II B 16.4

2.

III C – 0.61
3.

1. I – A; II – B; III – C
2. I – B; II – A; III – C 4.
3. I – B; II – C; III – A
4. I – C; II – B; III – A

94. ि नम्नरलिभत अर ििया िें ें ववरगचत ें ुख्य
उयपाद है 95. उयपाद A की ओर अग्रीररत करने वाले पेप्ााइै
बह न के ीरल ींशलेषण के रलए ऐें hनो अम्ल B
की पाशवद श्रंभ
ृ ला होनh चािहएर

1.

2. 1. XH = -OH
2. XH = -(CH2)4NH
3. XH = -p-(C6H4)OH
4. XH = -SH
3.
95. For the successful synthesis of peptide linkage
leading to the product A, the side chain of the
amino acid B should have

4.

94. The major product formed in the following
reaction sequence is 1. XH = -OH
2. XH = -(CH2)4NH
3. XH = -p-(C6H4)OH
4. XH = -SH

96. ि नम्नरलिभत अर ििया िें के ें ख्
ु य उयपाद A
तथा B ह।र

27

4.

1. 97. The intermediate A and the major product B in
2. the following reaction are

3.

4.

1.
96. The major products A and B in the following
reaction sequence are

2.

1. 3.
2.

3.
4.

4.

98. ि नम्नरलिभत अर ििया के रलए ीही ें ध्यवती जो
97. ि नम्नरलिभत अर ििया ें ें ध्यवती A तथा ें ुख्य
उयपाद की और अग्रीररत करता है , वह है
उयपाद B ह।र

1. 2.

1.

3. 4.

2.

98. The correct intermediate which leads to the
3. product in the following reaction is

28

1. 2.
4.

3. 4.
100. ि नम्नरलिभत अर ििया िें ें ें ुख्य उयपाद A
तथा B ह।र

99. ि नम्नरलिभत प पाहतरण ें A के इलेक्ट्रोीाइक्लीकरण
की रत्णाली तथा ें ुख्य उयपाद B ह।र

1.

2.

1.
3.

4.
2.
100. The major products A and B in the following
reaction sequence are

3.

4. 1.
2.

3.
99. In the following transformation, the mode of
electrocyclization A and the major product B 4.
are

101. D ीरल आवती दोलक के एक क्वाहाें के
आइिन रलनों की ीें रें ि त के रलए ीही कथन है
1. ी h आइिन रलन केवल ीें रलन ह।
1. क्योंिक वव व एक ीें रलन है र
2. ी h आइिन रलन केवल ववषें रलन ह।
यद्यवप वव व एक ीें रलन है र
2. 3. आइिन रलनों की कोई ववषें -ीें
ीें रें ि त नहीं है र
4. ी h आइिन रलन ववषें अहयथा ीें
3.
रलन है क्योंिक वव व एक ीें रलन है र

29

101. The correct statement about the symmetry of first order correction to the energy for the
the eigenfunctions of a quantum of D ground state is
harmonic oscillator is 1. but
1. All the eigenfunctions are only even 2.
functions, because the potential is an 3.
even function.
4.
2. All the eigenfunctions are only odd
functions, although the potential is an
even function. 104. नhचे गचि द्वारा एथhलीन का ीाें ाहय प प रत्स्तुत
3. The eigenfunctions have no odd-even िकया िया है , यह
symmetry.
4. All the eigenfunctions are either odd or
even functions, because the potential is
an even function.

102. एक ही लम्बाई के D , D विद तथा
D घन बाक्ीों ें द्ववतhय तथा रत्थें उयतेजजत 1. केवल IR ीििय है
अवस्थाओं की ऊजादओं ें अहतर ( के रलए 2. केवल राें न ीििय है
ीही कथन है र 3. IR तथा राें न दोनों ीििय है
1. D D 4. न IR ीििय है औन न राें न ीििय है
D
2. D D 104. The normal mode of ethylene represented, by
D the figure below, is
3. D D
D
4. D D
D

102. The correct statement about the difference of 1. only IR active
second and first excited state energies ( of 2. only Raman active
a particle in D , D square and D 3. both IR and Raman active
cubic boxes with same length for each, is 4. neither IR nor Raman active
1. D D
D 105. ि नम्नरलिभत ें ीे युग्ें जजीें दोनों िोलीय ााप
2. D D
तथा ीें रें त ााप ह।, वह है
D
3. D D 1. , 2. ,
D 3. 4. ,
4. D D
D 105. The pair that contains a spherical top and a
symmetric top, among the following, is
1. , 2. ,
103. एक ववें hय क्वाहाें ीरल आवती दोलक एक
3. 4. ,
वव व ीे क्षोर त है र ि नम्नतें अवस्था की
ऊजाद के रलए रत्थें कोिा की ीं्ुद्ग है र 106. एक त्रबहद ु ीें ुह (कोिा 4) की अर लक्षण ीारणh का
1. परहतु अं् नhचे िदया है र
2.
3. E
4.

103. A one-dimesnsional quantum harmonic
oscillator is perturbed by a potential . The ? ? ? ?

30

के चार अर लक्षण ह।, िें ्: 109. The term symbol for the ground state of a metal
1. 1, 1, 1, 1 2. 2, 0, 0, 1 ion is 3P2. The residual entropy of a crystal of a
salt of this metal ion at 0 K is
3. 1, i, i, 1 4. 1,  i, i, 1
1. 2.
106. A part of the character table of a point group 3. 4.
(of order 4) is given below.
110. रबर बैहै के तनन ें ,
E
ि नम्नरलिभत ींबं ों ें ीे कौन-ीा ीयय है ?
1.
? ? ? ? 2.

The four characters of are, respectively 3.
1. 1, 1, 1, 1 2. 2, 0, 0, 1
3. 1, i, i, 1 4. 1,  i, i, 1 4.

107. रत्ोपhनाइल ें ूलक के रलए इलेक्ट्रोि नक
110. In stretching of a rubber band,
ींिें ण की ऊजाद है र हकल रीद् ांत के ढोचें
के अहतिदत ींिें ण के रलए ऊजाद होिhर Which of the following relations is true?
1. 2. 1.
3. 4.
2.
107. The electronic transition energy from
in propenyl radical is . Within the frame 3.
work of Huckel theory, the transitions energy
from would be 4.
1. 2.
3. 4.
111. चार वव ेद्य अणु, ऊजाद अवस्थाओं E1 तथा E2 ें ,
108. 1
H तथा C के रलए g-िुणक िें ्: 5.6 तथा 1.4
13 िें ्: 2 तथा 3 अपभ्रष्ाता के ीाथ ववतररत ह।र 3
ह।र चुम्बकीय क्षेि बल के एक ही ें ान के रलए H
1 अणु ऊजाद स्तर E1 तथा एक ऊजाद स्तर E2 ें हो
600 MHz पर अनुनादन करता है , तो 13
C का तो ें ाइिोस्ाे ाों की ींख्या है
अनुनादन होिा 1. 4 2. 12
3. 96 4. 192
1. 2400 MHz पर 2. 600 MHz पर
3. 150 MHz पर 4. 38 MHz पर 111. Four distinguishable molecules are distributed
in energy levels E1 and E2 with degeneracy of 2
108. The g-factors of 1H and 13C are 5.6 and 1.4 and 3, respectively. Number of microstates,
respectively. For the same value of the with 3 molecules in energy level E1 and one in
magnetic field strength, if the 1H resonates at energy level E2, is
600 MHz, the 13C would resonate at 1. 4 2. 12
1. 2400 MHz 2. 600 MHz 3. 96 4. 192
3. 150 MHz 4. 38 MHz
112. आद्द िैी का एक ें ोल गचि ें िदभाए िये चिीय
109. ातु आयन की ि नम्नतें अवस्था के रलए पद रत्िें (ABCDA) ें , त्रबहद ु A ीे रत्ारम् कर चार
रत्तhक P2 है र 0 K पर इी ातु आयन के एक
3
उयिें णhय चरणों ीे िुजरता है र रत्िें ें िकया
ीाला के ििस्ाल की अव्ेष एहट्रोपh है िया कुल कायद है र
1. 2.
3. 4.

31

के रलए पूव-द अनुें ाि नत ववद्युत वाहक बल (emf) है
1. 2.
3. 4.

114. The predicted electromotive force (emf) of the
electrochemical cell

1.
is
2.
3.
1. 2.
4.
3. 4.

112. One mole of an ideal gas undergoes a cyclic 115. एक बहुलक के रलए ि नम्नरलिभत ें ोलर ींहि त
process (ABCDA) starting from point A
through 4 reversible steps as shown in the ववतरण है
figure. Total work done in the process is
अणुओं की ें ोलर ींहि त (g.mol )
–1

ींख्या
50 5000
75 6000

बहुलक के रलए पररकरलत ींख्या औीत ें ोलर
ींहि त है र
1.
1. 5200 2. 5600
2. 3. 5800 4. 6000

3. 115. A polymer has the following molar mass
4. distribution

Number of Molar mass (g.mol–1)
113. एक ववद्युत-अपघ्य के ववलयन की ववर्ष्ा molecules
चालकता 0.2 है , तथा ीेल ि नयतांक 50 5000
है र ववलयन की चालकता है
75 6000
1. 2. The calculated number average molar mass
3. 4. of the polymer is
1. 5200 2. 5600
113. If the specific conductance of an electrolyte 3. 5800 4. 6000
solution is 0.2 and cell constant is
, the conductance of the solution is
116. ववषें लम्बाक्ष एकक ीेल के (123) तलों के ें ध्य
1. 2.
3. 4. पथ
ृ क्करण 3.12 nm है र (246) तथा (369) तलों के
ें ध्य पथ
ृ क्करण है िें ्:
114. ववद्युतराीायनh ीेल 1. 1.56 nm तथा 1.04 nm
2. 1.04 nm तथा 1.56 nm
is 3. 3.12 nm तथा 1.50 nm
4. 1.04 nm तथा 3.12 nm

32

116. The separation of the (123) planes of an 119. Reaction between A and B is carried out for
orthorhombic unit cell is 3.12 nm. The different initial concentrations and the
separation of (246) and (369) planes are, corresponding half-life times are measured.
respectively, The data are listed in the table:
1. 1.56 nm and 1.04 nm
2. 1.04 nm and 1.56 nm Entry
3. 3.12 nm and 1.50 nm 1 500 10 60
4. 1.04 nm and 3.12 nm 2 500 20 60
3 10 500 60
117. एह हाइें उयरत्ेररत अर ििया के रलए (1/दर) VS 4 20 500 30
(1/ीबस्ट्रे ा ीाहद्रता) ीे रत्ाप्त स्लोप तथा अंत: भंै
The rate can be represented as
िें ्: 300 तथा 2 105 ह।र इी एह हाइें के रलए
1. 2.
ें ाइकेरली-ें ेहान जस्थरांक इी अर ििया ें है र 3. 4.
1. 5 106 M 2. 5 10–6 M
3. 1.5 103 M 4. 1.5 10–3 M 120. अर ििया के रलए दर ि नयतांक के
ीम्ें ुभ आयि नक बल का अंकन (गचि दे िभए) जजी
117. The slope and intercept obtained from (1/Rate)
against (1/substrate concentration) of an रे भा का अनी
ु रण करता है , वह है
enzyme catalyzed reaction are 300 and 2 105,
respectively. The Michaelis-Menten constant of
the enzyme in this reaction is
1. 5 106 M 2. 5 10–6 M
3. 1.5 10 M 3
4. 1.5 10–3 M

118. एक पष्ृ ठ तनाव के द्रव ें ववरगचत, त्रिजया r की
िोलाकार कोार के अहदर दाब जजी रत्कार
बाह्य दाब ( ) ीे ींबंग त है , वह है
1. 2. 1. I 2. II
3. 4. 3. III 4. IV

118. The pressure inside a spherical cavity 120. The plot of the rate constant vs. ionic strength
with a radius r formed in a liquid with surface of the reaction follows the line (refer
tension is related to the external pressure to the figure)
( ) as
1. 2.
3. 4.

119. A तथा B के ें ध्य अर ििया ववर हन रत्ारं र क
ीाहद्रताओं पर करके ींित अ द आयु ें ापh ियh है र
आंकैे ीारणh ें ीूचhबद् ह।
Entry
1 500 10 60 1. I 2. II
2 500 20 60 3. III 4. IV
3 10 500 60
4 20 500 30
दर को इी रत्कार ि नप वपत कर ीकते ह।र
1. 2.
3. 4.